CAS 367-65-7 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)-o-phenylenediamine, 97% , 3,5-Bis(trifluoromethyl)-1,2-diaminobenzene, 97%, 97%. Offered by: Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 1g, 5g, 250mg.
3,5-bis(trifluoromethyl)benzene-1,2-diamine (CAS 367-65-7) is a chemical compound with the molecular formula C8H6F6N2 and a molecular weight of 244.14 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)benzene-1,2-diamine. InChIKey: BRLIJPMFMGTIAW-UHFFFAOYSA-N.
| Molecular formula | C8H6F6N2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 3,5-bis(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | BRLIJPMFMGTIAW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)N)C(F)(F)F |
Computed by PubChem (NCBI)