CAS 30454-92-3 is the registry number for 4,5-Bis(trifluoromethyl)benzene-1,2-diamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
4,5-bis(trifluoromethyl)benzene-1,2-diamine (CAS 30454-92-3) is a chemical compound with the molecular formula C8H6F6N2 and a molecular weight of 244.14 g/mol. IUPAC name: 4,5-bis(trifluoromethyl)benzene-1,2-diamine. InChIKey: UOTZJBMBHUUZJK-UHFFFAOYSA-N.
| Molecular formula | C8H6F6N2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 4,5-bis(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | UOTZJBMBHUUZJK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)N)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)