CAS 106896-48-4 appears in our catalog under these names: Methyl 3–amino–2–bromobenzoate, methyl 3-amino-2-bromobenzoate, Methyl 3-amino-2-bromobenzoate 97%, Methyl 3-amino-2-bromobenzoate, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 500mg, 5g, 100g, 100mg, 25g.
Methyl 3-amino-2-bromobenzoate (CAS 106896-48-4) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: methyl 3-amino-2-bromobenzoate. InChIKey: NIXWZYZFLFEHMB-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | methyl 3-amino-2-bromobenzoate |
| InChIKey | NIXWZYZFLFEHMB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)N)Br |
Computed by PubChem (NCBI)