Products 106918-32-5

CAS 106918-32-5 is the registry number for Methyl 4-(2-oxoethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 4-(2-oxoethyl)benzoate (CAS 106918-32-5) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: methyl 4-(2-oxoethyl)benzoate. InChIKey: HKTGGDULWDLYKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O3
Molecular weight178.18 g/mol
IUPAC namemethyl 4-(2-oxoethyl)benzoate
InChIKeyHKTGGDULWDLYKQ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)CC=O

Computed by PubChem (NCBI)