Products 1070295-76-9

CAS 1070295-76-9 is the registry number for (R)-tert-Butyl (pyrrolidin-2-ylmethyl)carbamate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 500mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[[(2R)-pyrrolidin-2-yl]methyl]carbamate;hydrochloride (CAS 1070295-76-9) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[[(2R)-pyrrolidin-2-yl]methyl]carbamate;hydrochloride. InChIKey: TXIPBKSPZRMDNE-DDWIOCJRSA-N.

Identity
Molecular formulaC10H21ClN2O2
Molecular weight236.74 g/mol
IUPAC nametert-butyl N-[[(2R)-pyrrolidin-2-yl]methyl]carbamate;hydrochloride
InChIKeyTXIPBKSPZRMDNE-DDWIOCJRSA-N
SMILESCC(C)(C)OC(=O)NC[C@H]1CCCN1.Cl

Computed by PubChem (NCBI)