Products 1071286-94-6

CAS 1071286-94-6 is the registry number for Valsartan Impurity 37. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoic acid (CAS 1071286-94-6) is a chemical compound with the molecular formula C19H20N2O2 and a molecular weight of 308.4 g/mol. IUPAC name: (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoic acid. InChIKey: ACKDVZDXBQHGKY-SFHVURJKSA-N.

Identity
Molecular formulaC19H20N2O2
Molecular weight308.4 g/mol
IUPAC name(2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoic acid
InChIKeyACKDVZDXBQHGKY-SFHVURJKSA-N
SMILESCC(C)[C@@H](C(=O)O)NCC1=CC=C(C=C1)C2=CC=CC=C2C#N

Computed by PubChem (NCBI)