CAS 473918-50-2 is the registry number for 1-(4-N-tert-Butoxycarbonylaminophenyl)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
Tert-butyl N-(4-indol-1-ylphenyl)carbamate (CAS 473918-50-2) is a chemical compound with the molecular formula C19H20N2O2 and a molecular weight of 308.4 g/mol. IUPAC name: tert-butyl N-(4-indol-1-ylphenyl)carbamate. InChIKey: WEEYUCJMXQQKTD-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | tert-butyl N-(4-indol-1-ylphenyl)carbamate |
| InChIKey | WEEYUCJMXQQKTD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)N2C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)