Products 219312-89-7

CAS 219312-89-7 is the registry number for (9H-Fluoren-9-yl)methyl piperazine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

9H-fluoren-9-ylmethyl piperazine-1-carboxylate (CAS 219312-89-7) is a chemical compound with the molecular formula C19H20N2O2 and a molecular weight of 308.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl piperazine-1-carboxylate. InChIKey: GZBLLBMXRTZBSX-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20N2O2
Molecular weight308.4 g/mol
IUPAC name9H-fluoren-9-ylmethyl piperazine-1-carboxylate
InChIKeyGZBLLBMXRTZBSX-UHFFFAOYSA-N
SMILESC1CN(CCN1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)