Products 1071296-09-7
CAS 1071296-09-7 is the registry number for 2-Chloro-n-[3-(hydrazinocarbonyl)phenyl]benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-N-[3-(hydrazinecarbonyl)phenyl]benzamide (CAS 1071296-09-7) is a chemical compound with the molecular formula C14H12ClN3O2 and a molecular weight of 289.71 g/mol. IUPAC name: 2-chloro-N-[3-(hydrazinecarbonyl)phenyl]benzamide. InChIKey: YPZUEZIWOGKFLM-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3O2 |
|---|---|
| Molecular weight | 289.71 g/mol |
| IUPAC name | 2-chloro-N-[3-(hydrazinecarbonyl)phenyl]benzamide |
| InChIKey | YPZUEZIWOGKFLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=CC(=C2)C(=O)NN)Cl |
Computed by PubChem (NCBI)