Products 1421312-08-4

CAS 1421312-08-4 is the registry number for 3-Chloro-5,7-dihydro-pyrrolo[3,4-c]pyridazine-6-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl 3-chloro-5,7-dihydropyrrolo[3,4-c]pyridazine-6-carboxylate (CAS 1421312-08-4) is a chemical compound with the molecular formula C14H12ClN3O2 and a molecular weight of 289.71 g/mol. IUPAC name: benzyl 3-chloro-5,7-dihydropyrrolo[3,4-c]pyridazine-6-carboxylate. InChIKey: ZYNKTKJPCNBEJX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12ClN3O2
Molecular weight289.71 g/mol
IUPAC namebenzyl 3-chloro-5,7-dihydropyrrolo[3,4-c]pyridazine-6-carboxylate
InChIKeyZYNKTKJPCNBEJX-UHFFFAOYSA-N
SMILESC1C2=CC(=NN=C2CN1C(=O)OCC3=CC=CC=C3)Cl

Computed by PubChem (NCBI)