CAS 1373237-01-4 is the registry number for (Z)-[Amino(4-aminophenyl)methylidene]amino 4-chlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[(Z)-[amino-(4-aminophenyl)methylidene]amino] 4-chlorobenzoate (CAS 1373237-01-4) is a chemical compound with the molecular formula C14H12ClN3O2 and a molecular weight of 289.71 g/mol. IUPAC name: [(Z)-[amino-(4-aminophenyl)methylidene]amino] 4-chlorobenzoate. InChIKey: IXAYTQLAXRRFKC-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3O2 |
|---|---|
| Molecular weight | 289.71 g/mol |
| IUPAC name | [(Z)-[amino-(4-aminophenyl)methylidene]amino] 4-chlorobenzoate |
| InChIKey | IXAYTQLAXRRFKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1/C(=N/OC(=O)C2=CC=C(C=C2)Cl)/N)N |
Computed by PubChem (NCBI)