CAS 1071466-61-9 appears in our catalog under these names: 3,3'-Diallylbisphenol a diacetate, 95%, 3,3'-Diallylbisphenol A diacetate, epoxy curative, EC-392 . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 100g.
[4-[2-(4-acetyloxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] acetate (CAS 1071466-61-9) is a chemical compound with the molecular formula C25H28O4 and a molecular weight of 392.5 g/mol. IUPAC name: [4-[2-(4-acetyloxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] acetate. InChIKey: GJTZQXNRNNDGRG-UHFFFAOYSA-N.
| Molecular formula | C25H28O4 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | [4-[2-(4-acetyloxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] acetate |
| InChIKey | GJTZQXNRNNDGRG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C(C)(C)C2=CC(=C(C=C2)OC(=O)C)CC=C)CC=C |
Computed by PubChem (NCBI)