CAS 133699-09-9 appears in our catalog under these names: Tr-peg4, 95%, Tr–PEG3–OH, Tr-PEG3-OH 95%, 2-(2-(2-(Trityloxy)ethoxy)ethoxy)ethanol, 98%, 98%, Tr-PEG3-OH, 99.55%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 100g, 25g, 10 g, 1 g, 50 g, 5 g.
2-[2-(2-trityloxyethoxy)ethoxy]ethanol (CAS 133699-09-9) is a chemical compound with the molecular formula C25H28O4 and a molecular weight of 392.5 g/mol. IUPAC name: 2-[2-(2-trityloxyethoxy)ethoxy]ethanol. InChIKey: CKYIMQGYUMGSEO-UHFFFAOYSA-N.
| Molecular formula | C25H28O4 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 2-[2-(2-trityloxyethoxy)ethoxy]ethanol |
| InChIKey | CKYIMQGYUMGSEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCCOCCOCCO |
Computed by PubChem (NCBI)