Products 79295-49-1
CAS 79295-49-1 appears in our catalog under these names: Mulberrofuran B, Mulberrofuran B, 99.81%, MULBERROFURAN B, ≥98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg, 10mg.
5-[7-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-methoxy-1-benzofuran-2-yl]benzene-1,3-diol (CAS 79295-49-1) is a chemical compound with the molecular formula C25H28O4 and a molecular weight of 392.5 g/mol. IUPAC name: 5-[7-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-methoxy-1-benzofuran-2-yl]benzene-1,3-diol. InChIKey: OZLRLDMVAJOIKX-CAOOACKPSA-N.
| Molecular formula | C25H28O4 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 5-[7-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-methoxy-1-benzofuran-2-yl]benzene-1,3-diol |
| InChIKey | OZLRLDMVAJOIKX-CAOOACKPSA-N |
| SMILES | CC(=CCC/C(=C/CC1=C(C=CC2=C1OC(=C2)C3=CC(=CC(=C3)O)O)OC)/C)C |
Computed by PubChem (NCBI)
Synonyms:
Mulberrofuran B, orb1943023