CAS 1071638-29-3 is the registry number for methyl 4-nitro-2-propoxybenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 4-nitro-2-propoxybenzoate (CAS 1071638-29-3) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: methyl 4-nitro-2-propoxybenzoate. InChIKey: BZURTLJHIMKCKC-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | methyl 4-nitro-2-propoxybenzoate |
| InChIKey | BZURTLJHIMKCKC-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)