CAS 1071673-21-6 appears in our catalog under these names: 5-Benzylisoxazol-3-amine, 98%, 5-Benzylisoxazol-3-Amine, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
5-benzyl-1,2-oxazol-3-amine (CAS 1071673-21-6) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 5-benzyl-1,2-oxazol-3-amine. InChIKey: MJJDMESIISMXGF-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 5-benzyl-1,2-oxazol-3-amine |
| InChIKey | MJJDMESIISMXGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=NO2)N |
Computed by PubChem (NCBI)