CAS 107202-62-0 appears in our catalog under these names: Erythro-n-boc-l-cyclohexylalanine epoxide, 95%, tert-Butyl ((S)-2-cyclohexyl-1-((S)-oxiran-2-yl)ethyl)carbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl N-[(1S)-2-cyclohexyl-1-[(2S)-oxiran-2-yl]ethyl]carbamate (CAS 107202-62-0) is a chemical compound with the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. IUPAC name: tert-butyl N-[(1S)-2-cyclohexyl-1-[(2S)-oxiran-2-yl]ethyl]carbamate. InChIKey: JRMDRWOEBLIOTE-QWHCGFSZSA-N.
| Molecular formula | C15H27NO3 |
|---|---|
| Molecular weight | 269.38 g/mol |
| IUPAC name | tert-butyl N-[(1S)-2-cyclohexyl-1-[(2S)-oxiran-2-yl]ethyl]carbamate |
| InChIKey | JRMDRWOEBLIOTE-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1CCCCC1)[C@H]2CO2 |
Computed by PubChem (NCBI)