CAS 882028-43-5 is the registry number for tert-Butyl ((2R,3R,5S,6S)-6-allyl-2,5-dimethyltetrahydro-2H-pyran-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamate (CAS 882028-43-5) is a chemical compound with the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. IUPAC name: tert-butyl N-[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamate. InChIKey: XZOYPHIIEILQHM-LOWDOPEQSA-N.
| Molecular formula | C15H27NO3 |
|---|---|
| Molecular weight | 269.38 g/mol |
| IUPAC name | tert-butyl N-[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]carbamate |
| InChIKey | XZOYPHIIEILQHM-LOWDOPEQSA-N |
| SMILES | C[C@H]1C[C@H]([C@H](O[C@H]1CC=C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)