CAS 68489-14-5 appears in our catalog under these names: Ethyl 3-(p-Menthane-3-carboxamido)acetate, >95% (HPLC), WS5, WS5, 99.11%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 500mg, 5 g.
Ethyl 2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]acetate (CAS 68489-14-5) is a chemical compound with the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. IUPAC name: ethyl 2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]acetate. InChIKey: GWRCTWAPTXBPHW-FRRDWIJNSA-N.
| Molecular formula | C15H27NO3 |
|---|---|
| Molecular weight | 269.38 g/mol |
| IUPAC name | ethyl 2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]acetate |
| InChIKey | GWRCTWAPTXBPHW-FRRDWIJNSA-N |
| SMILES | CCOC(=O)CNC(=O)[C@@H]1C[C@@H](CC[C@H]1C(C)C)C |
Computed by PubChem (NCBI)