Products 107220-28-0
CAS 107220-28-0 appears in our catalog under these names: rac-Cevimeline HCl, rac,cis-Cevimeline Hydrochloride Salt, >95% (HPLC), Cevimeline hydrochloride, Cevimeline (hydrochloride), Cevimeline HCl 91% HPLC. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 25mg, 50mg, 2mg, 1mg, 10mg, 5mg.
(2R,5R)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane];hydrochloride (CAS 107220-28-0) is a chemical compound with the molecular formula C10H18ClNOS and a molecular weight of 235.77 g/mol. IUPAC name: (2R,5R)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane];hydrochloride. InChIKey: SURWTGAXEIEOGY-GHXDPTCOSA-N.
| Molecular formula | C10H18ClNOS |
|---|---|
| Molecular weight | 235.77 g/mol |
| IUPAC name | (2R,5R)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane];hydrochloride |
| InChIKey | SURWTGAXEIEOGY-GHXDPTCOSA-N |
| SMILES | C[C@@H]1O[C@]2(CN3CCC2CC3)CS1.Cl |
Computed by PubChem (NCBI)