Products 2124269-72-1
CAS 2124269-72-1 is the registry number for Cevimeline Hydrochloride (Mixture of Diastereomers). Offered by: TRC. Available pack sizes: 100mg.
(5S)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane];hydrochloride (CAS 2124269-72-1) is a chemical compound with the molecular formula C10H18ClNOS and a molecular weight of 235.77 g/mol. IUPAC name: (5S)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane];hydrochloride. InChIKey: SURWTGAXEIEOGY-LQRGNCEWSA-N.
| Molecular formula | C10H18ClNOS |
|---|---|
| Molecular weight | 235.77 g/mol |
| IUPAC name | (5S)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane];hydrochloride |
| InChIKey | SURWTGAXEIEOGY-LQRGNCEWSA-N |
| SMILES | CC1O[C@@]2(CN3CCC2CC3)CS1.Cl |
Computed by PubChem (NCBI)