Products 107220-29-1
CAS 107220-29-1 appears in our catalog under these names: trans-Cevimeline HCl, Cevimeline Impurity 7(trans-Cevimeline HCl), rac,trans-Cevimeline Hydrochloride, trans-Cevimeline (hydrochloride). Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 10 mg.
(2S,5R)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane];hydrochloride (CAS 107220-29-1) is a chemical compound with the molecular formula C10H18ClNOS and a molecular weight of 235.77 g/mol. IUPAC name: (2S,5R)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane];hydrochloride. InChIKey: SURWTGAXEIEOGY-KXNXZCPBSA-N.
| Molecular formula | C10H18ClNOS |
|---|---|
| Molecular weight | 235.77 g/mol |
| IUPAC name | (2S,5R)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane];hydrochloride |
| InChIKey | SURWTGAXEIEOGY-KXNXZCPBSA-N |
| SMILES | C[C@H]1O[C@]2(CN3CCC2CC3)CS1.Cl |
Computed by PubChem (NCBI)