Products 1072207-10-3
CAS 1072207-10-3 appears in our catalog under these names: Ethyl 4-fluoro-2-nitrobenzoate, 97%, Ethyl 4-Fluoro-2-nitrobenzoate, 98%, Ethyl 4–Fluoro–2–nitrobenzoate, 4-Fluoro-2-nitrobenzoic acid ethyl ester, Ethyl 4-Fluoro-2-nitrobenzoate, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 100mg, 250mg, 100g.
Ethyl 4-fluoro-2-nitrobenzoate (CAS 1072207-10-3) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: ethyl 4-fluoro-2-nitrobenzoate. InChIKey: MTDIULWIFTZWEF-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | ethyl 4-fluoro-2-nitrobenzoate |
| InChIKey | MTDIULWIFTZWEF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)