CAS 107257-28-3 appears in our catalog under these names: Pk 14105, 95%, PK14105, 98+%, PK14105, PK14105, 95%, 95%, PK14105, 99.59%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 2mg, 5mg, 25mg, 50mg, 10mg.
N-butan-2-yl-1-(2-fluoro-5-nitrophenyl)-N-methylisoquinoline-3-carboxamide (CAS 107257-28-3) is a chemical compound with the molecular formula C21H20FN3O3 and a molecular weight of 381.4 g/mol. IUPAC name: N-butan-2-yl-1-(2-fluoro-5-nitrophenyl)-N-methylisoquinoline-3-carboxamide. InChIKey: GXXKDYZSBGOJQN-UHFFFAOYSA-N.
| Molecular formula | C21H20FN3O3 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | N-butan-2-yl-1-(2-fluoro-5-nitrophenyl)-N-methylisoquinoline-3-carboxamide |
| InChIKey | GXXKDYZSBGOJQN-UHFFFAOYSA-N |
| SMILES | CCC(C)N(C)C(=O)C1=CC2=CC=CC=C2C(=N1)C3=C(C=CC(=C3)[N+](=O)[O-])F |
Computed by PubChem (NCBI)