Products 3029827-91-3

CAS 3029827-91-3 is the registry number for Glucosylceramide synthase-IN-3, 99.11%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10mM/1mL, 25 mg, 50 mg, 10 mg.

Structural formula: {0} (CAS {1})

[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[2-(4-fluorophenyl)-1,3-benzoxazol-4-yl]carbamate (CAS 3029827-91-3) is a chemical compound with the molecular formula C21H20FN3O3 and a molecular weight of 381.4 g/mol. IUPAC name: [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[2-(4-fluorophenyl)-1,3-benzoxazol-4-yl]carbamate. InChIKey: MLVNGCMNEYHLOF-SFHVURJKSA-N.

Identity
Molecular formulaC21H20FN3O3
Molecular weight381.4 g/mol
IUPAC name[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[2-(4-fluorophenyl)-1,3-benzoxazol-4-yl]carbamate
InChIKeyMLVNGCMNEYHLOF-SFHVURJKSA-N
SMILESC1CN2CCC1[C@H](C2)OC(=O)NC3=C4C(=CC=C3)OC(=N4)C5=CC=C(C=C5)F

Computed by PubChem (NCBI)