CAS 3029827-91-3 is the registry number for Glucosylceramide synthase-IN-3, 99.11%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10mM/1mL, 25 mg, 50 mg, 10 mg.
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[2-(4-fluorophenyl)-1,3-benzoxazol-4-yl]carbamate (CAS 3029827-91-3) is a chemical compound with the molecular formula C21H20FN3O3 and a molecular weight of 381.4 g/mol. IUPAC name: [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[2-(4-fluorophenyl)-1,3-benzoxazol-4-yl]carbamate. InChIKey: MLVNGCMNEYHLOF-SFHVURJKSA-N.
| Molecular formula | C21H20FN3O3 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[2-(4-fluorophenyl)-1,3-benzoxazol-4-yl]carbamate |
| InChIKey | MLVNGCMNEYHLOF-SFHVURJKSA-N |
| SMILES | C1CN2CCC1[C@H](C2)OC(=O)NC3=C4C(=CC=C3)OC(=N4)C5=CC=C(C=C5)F |
Computed by PubChem (NCBI)