Products 149092-00-2
CAS 149092-00-2 is the registry number for Antibacterial agent 322. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-fluoro-1-(4-methylphenyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid (CAS 149092-00-2) is a chemical compound with the molecular formula C21H20FN3O3 and a molecular weight of 381.4 g/mol. IUPAC name: 6-fluoro-1-(4-methylphenyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid. InChIKey: QEFDSJQBPGAMEG-UHFFFAOYSA-N.
| Molecular formula | C21H20FN3O3 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | 6-fluoro-1-(4-methylphenyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
| InChIKey | QEFDSJQBPGAMEG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C=C(C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)C(=O)O |
Computed by PubChem (NCBI)