Products 1072855-47-0
CAS 1072855-47-0 is the registry number for 5-(3,3,3-Trifluoropropoxy)pyrazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(3,3,3-trifluoropropoxy)pyrazine-2-carboxylic acid (CAS 1072855-47-0) is a chemical compound with the molecular formula C8H7F3N2O3 and a molecular weight of 236.15 g/mol. IUPAC name: 5-(3,3,3-trifluoropropoxy)pyrazine-2-carboxylic acid. InChIKey: NTCGBGWVHIVISB-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O3 |
|---|---|
| Molecular weight | 236.15 g/mol |
| IUPAC name | 5-(3,3,3-trifluoropropoxy)pyrazine-2-carboxylic acid |
| InChIKey | NTCGBGWVHIVISB-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)OCCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)