CAS 329782-05-0 appears in our catalog under these names: 3-Nitro-5-(2,2,2-trifluoroethoxy)aniline, 97%, 3-Nitro-5-(2,2,2-trifluoroethoxy)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 100mg.
3-nitro-5-(2,2,2-trifluoroethoxy)aniline (CAS 329782-05-0) is a chemical compound with the molecular formula C8H7F3N2O3 and a molecular weight of 236.15 g/mol. IUPAC name: 3-nitro-5-(2,2,2-trifluoroethoxy)aniline. InChIKey: GAUUCMLQGPSJKA-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O3 |
|---|---|
| Molecular weight | 236.15 g/mol |
| IUPAC name | 3-nitro-5-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | GAUUCMLQGPSJKA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])OCC(F)(F)F)N |
Computed by PubChem (NCBI)