CAS 1215206-37-3 is the registry number for N-Methyl-2-nitro-4-(trifluoromethoxy)aniline, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
N-methyl-2-nitro-4-(trifluoromethoxy)aniline (CAS 1215206-37-3) is a chemical compound with the molecular formula C8H7F3N2O3 and a molecular weight of 236.15 g/mol. IUPAC name: N-methyl-2-nitro-4-(trifluoromethoxy)aniline. InChIKey: OEMXVJJCFPOMMU-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O3 |
|---|---|
| Molecular weight | 236.15 g/mol |
| IUPAC name | N-methyl-2-nitro-4-(trifluoromethoxy)aniline |
| InChIKey | OEMXVJJCFPOMMU-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)OC(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)