Products 1072944-47-8
CAS 1072944-47-8 is the registry number for Methyl 5-cyclopropyl-1-(pyridin-2-yl)-1H-pyrazole-4-carboxylate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Methyl 5-cyclopropyl-1-pyridin-2-ylpyrazole-4-carboxylate (CAS 1072944-47-8) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: methyl 5-cyclopropyl-1-pyridin-2-ylpyrazole-4-carboxylate. InChIKey: KJDDTEUYLRYFRF-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | methyl 5-cyclopropyl-1-pyridin-2-ylpyrazole-4-carboxylate |
| InChIKey | KJDDTEUYLRYFRF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(N=C1)C2=CC=CC=N2)C3CC3 |
Computed by PubChem (NCBI)