Products 1133115-58-8
CAS 1133115-58-8 is the registry number for Methyl 2-amino-4-p-tolylpyrimidine-5-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 2-amino-4-(4-methylphenyl)pyrimidine-5-carboxylate (CAS 1133115-58-8) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: methyl 2-amino-4-(4-methylphenyl)pyrimidine-5-carboxylate. InChIKey: RURVMBMZJVLGHL-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | methyl 2-amino-4-(4-methylphenyl)pyrimidine-5-carboxylate |
| InChIKey | RURVMBMZJVLGHL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=NC=C2C(=O)OC)N |
Computed by PubChem (NCBI)