Products 932334-10-6

CAS 932334-10-6 is the registry number for 4-([(3-Aminopyridin-2-yl)amino]methyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

4-[[(3-amino-2-pyridinyl)amino]methyl]benzoic acid (CAS 932334-10-6) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: 4-[[(3-amino-2-pyridinyl)amino]methyl]benzoic acid. InChIKey: FWRPELRETWATEG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13N3O2
Molecular weight243.26 g/mol
IUPAC name4-[[(3-amino-2-pyridinyl)amino]methyl]benzoic acid
InChIKeyFWRPELRETWATEG-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)NCC2=CC=C(C=C2)C(=O)O)N

Computed by PubChem (NCBI)