Products 1072945-54-0

CAS 1072945-54-0 is the registry number for 5-Bromo-2-methoxyaniline hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-bromo-2-methoxyaniline;hydrochloride (CAS 1072945-54-0) is a chemical compound with the molecular formula C7H9BrClNO and a molecular weight of 238.51 g/mol. IUPAC name: 5-bromo-2-methoxyaniline;hydrochloride. InChIKey: SUNKHSMCARHIRV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9BrClNO
Molecular weight238.51 g/mol
IUPAC name5-bromo-2-methoxyaniline;hydrochloride
InChIKeySUNKHSMCARHIRV-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)Br)N.Cl

Computed by PubChem (NCBI)