Products 2089245-40-7
CAS 2089245-40-7 is the registry number for (1S)-1-(3-Bromopyridin-4-yl)ethan-1-ol hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1S)-1-(3-bromo-4-pyridinyl)ethanol;hydrochloride (CAS 2089245-40-7) is a chemical compound with the molecular formula C7H9BrClNO and a molecular weight of 238.51 g/mol. IUPAC name: (1S)-1-(3-bromo-4-pyridinyl)ethanol;hydrochloride. InChIKey: OMCBNTFJNARQET-JEDNCBNOSA-N.
| Molecular formula | C7H9BrClNO |
|---|---|
| Molecular weight | 238.51 g/mol |
| IUPAC name | (1S)-1-(3-bromo-4-pyridinyl)ethanol;hydrochloride |
| InChIKey | OMCBNTFJNARQET-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=NC=C1)Br)O.Cl |
Computed by PubChem (NCBI)