CAS 2230799-59-2 appears in our catalog under these names: 2-(Aminomethyl)-3-bromophenol hydrochloride, 98%, 2-(Aminomethyl)-3-bromophenol hydrochloride, 98%, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g.
2-(aminomethyl)-3-bromophenol;hydrochloride (CAS 2230799-59-2) is a chemical compound with the molecular formula C7H9BrClNO and a molecular weight of 238.51 g/mol. IUPAC name: 2-(aminomethyl)-3-bromophenol;hydrochloride. InChIKey: PIOJWNHRCFRVLF-UHFFFAOYSA-N.
| Molecular formula | C7H9BrClNO |
|---|---|
| Molecular weight | 238.51 g/mol |
| IUPAC name | 2-(aminomethyl)-3-bromophenol;hydrochloride |
| InChIKey | PIOJWNHRCFRVLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CN)O.Cl |
Computed by PubChem (NCBI)