Products 1072945-89-1
CAS 1072945-89-1 appears in our catalog under these names: 1-(4-Fluorophenyl)pyrazole-4-boronic acid, 1-(4-Fluorophenyl)pyrazole-4-boronic acid, 98%, 1–(4–Fluorophenyl)–1H–pyrazole–4–boronic acid. Offered by: Biosynth, Combi-blocks, AmBeed, GLPBio. Available pack sizes: 500mg, 1g, 5g, 10g, 250mg, 25mg, 5mg.
[1-(4-fluorophenyl)pyrazol-4-yl]boronic acid (CAS 1072945-89-1) is a chemical compound with the molecular formula C9H8BFN2O2 and a molecular weight of 205.98 g/mol. IUPAC name: [1-(4-fluorophenyl)pyrazol-4-yl]boronic acid. InChIKey: RKNFXJIPDALCBH-UHFFFAOYSA-N.
| Molecular formula | C9H8BFN2O2 |
|---|---|
| Molecular weight | 205.98 g/mol |
| IUPAC name | [1-(4-fluorophenyl)pyrazol-4-yl]boronic acid |
| InChIKey | RKNFXJIPDALCBH-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(1-(4-Fluorophenyl)-1H-pyrazol-4-yl)boronic acid, [1-(4-fluorophenyl)pyrazol-4-yl]boronic acid, [1-(4-fluorophenyl)-1H-pyrazol-4-yl]boronic acid, 1-(4-fluorophenyl)-1H-pyrazol-4-ylboronic acid, RKNFXJIPDALCBH-UHFFFAOYSA-N, 1-(4-fluorophenyl)-1H-pyrazole-4-boronic acid, 1-(4-fluorophenyl)-1H-pyrazole-4-ylboronic acid