CAS 2225178-95-8 appears in our catalog under these names: 1-(2-Fluorophenyl)-1H-pyrazole-4-boronic acid, 96%, 1–(2–Fluorophenyl)–1H–pyrazole–4–boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 25mg, 5mg.
[1-(2-fluorophenyl)pyrazol-4-yl]boronic acid (CAS 2225178-95-8) is a chemical compound with the molecular formula C9H8BFN2O2 and a molecular weight of 205.98 g/mol. IUPAC name: [1-(2-fluorophenyl)pyrazol-4-yl]boronic acid. InChIKey: XDGWEPJKYLLPLB-UHFFFAOYSA-N.
| Molecular formula | C9H8BFN2O2 |
|---|---|
| Molecular weight | 205.98 g/mol |
| IUPAC name | [1-(2-fluorophenyl)pyrazol-4-yl]boronic acid |
| InChIKey | XDGWEPJKYLLPLB-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2=CC=CC=C2F)(O)O |
Computed by PubChem (NCBI)