Products 2225155-88-2
CAS 2225155-88-2 is the registry number for 3–Fluoro–5–(imidazol–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(3-fluoro-5-imidazol-1-ylphenyl)boronic acid (CAS 2225155-88-2) is a chemical compound with the molecular formula C9H8BFN2O2 and a molecular weight of 205.98 g/mol. IUPAC name: (3-fluoro-5-imidazol-1-ylphenyl)boronic acid. InChIKey: OQGXKRHYUDKOLG-UHFFFAOYSA-N.
| Molecular formula | C9H8BFN2O2 |
|---|---|
| Molecular weight | 205.98 g/mol |
| IUPAC name | (3-fluoro-5-imidazol-1-ylphenyl)boronic acid |
| InChIKey | OQGXKRHYUDKOLG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)N2C=CN=C2)(O)O |
Computed by PubChem (NCBI)