CAS 1072946-00-9 appears in our catalog under these names: 3-Bromo-2-methoxypyridine-4-boronic acid, 97%, (3-Bromo-2-methoxypyridin-4-yl)boronic acid, 98%, 3-Bromo-2-methoxypyridine-4-boronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100mg, 250mg.
(3-bromo-2-methoxy-4-pyridinyl)boronic acid (CAS 1072946-00-9) is a chemical compound with the molecular formula C6H7BBrNO3 and a molecular weight of 231.84 g/mol. IUPAC name: (3-bromo-2-methoxy-4-pyridinyl)boronic acid. InChIKey: QOSVTTKSAVKBFO-UHFFFAOYSA-N.
| Molecular formula | C6H7BBrNO3 |
|---|---|
| Molecular weight | 231.84 g/mol |
| IUPAC name | (3-bromo-2-methoxy-4-pyridinyl)boronic acid |
| InChIKey | QOSVTTKSAVKBFO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)OC)Br)(O)O |
Computed by PubChem (NCBI)