Products 2121512-64-7

CAS 2121512-64-7 is the registry number for (6-bromo-5-methoxypyridin-3-yl)boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg.

Structural formula: {0} (CAS {1})

(6-bromo-5-methoxy-3-pyridinyl)boronic acid (CAS 2121512-64-7) is a chemical compound with the molecular formula C6H7BBrNO3 and a molecular weight of 231.84 g/mol. IUPAC name: (6-bromo-5-methoxy-3-pyridinyl)boronic acid. InChIKey: CBWDNGPSBFKVIL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7BBrNO3
Molecular weight231.84 g/mol
IUPAC name(6-bromo-5-methoxy-3-pyridinyl)boronic acid
InChIKeyCBWDNGPSBFKVIL-UHFFFAOYSA-N
SMILESB(C1=CC(=C(N=C1)Br)OC)(O)O

Computed by PubChem (NCBI)