Products 1242314-44-8
CAS 1242314-44-8 appears in our catalog under these names: 6-Bromo-2-methoxypyridine-3-boronic acid, 97%, 97%, 6-Bromo-2-methoxypyridine-3-boronic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 500mg.
(6-bromo-2-methoxy-3-pyridinyl)boronic acid (CAS 1242314-44-8) is a chemical compound with the molecular formula C6H7BBrNO3 and a molecular weight of 231.84 g/mol. IUPAC name: (6-bromo-2-methoxy-3-pyridinyl)boronic acid. InChIKey: XLWPUDBRICQBLE-UHFFFAOYSA-N.
| Molecular formula | C6H7BBrNO3 |
|---|---|
| Molecular weight | 231.84 g/mol |
| IUPAC name | (6-bromo-2-methoxy-3-pyridinyl)boronic acid |
| InChIKey | XLWPUDBRICQBLE-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Br)OC)(O)O |
Computed by PubChem (NCBI)