Products 1072946-02-1

CAS 1072946-02-1 is the registry number for N-(3-Chloro-2-methylphenyl) 3-boronobenzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

[3-[(3-chloro-2-methylphenyl)carbamoyl]phenyl]boronic acid (CAS 1072946-02-1) is a chemical compound with the molecular formula C14H13BClNO3 and a molecular weight of 289.52 g/mol. IUPAC name: [3-[(3-chloro-2-methylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: DRMRZGMHJMZALJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13BClNO3
Molecular weight289.52 g/mol
IUPAC name[3-[(3-chloro-2-methylphenyl)carbamoyl]phenyl]boronic acid
InChIKeyDRMRZGMHJMZALJ-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)C(=O)NC2=C(C(=CC=C2)Cl)C)(O)O

Computed by PubChem (NCBI)