CAS 957060-97-8 is the registry number for 3-Borono-N-(2-chloro-4-methylphenyl)benzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 100g, 500g, 1g.
[3-[(2-chloro-4-methylphenyl)carbamoyl]phenyl]boronic acid (CAS 957060-97-8) is a chemical compound with the molecular formula C14H13BClNO3 and a molecular weight of 289.52 g/mol. IUPAC name: [3-[(2-chloro-4-methylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: DKRYKTFMVWDUMU-UHFFFAOYSA-N.
| Molecular formula | C14H13BClNO3 |
|---|---|
| Molecular weight | 289.52 g/mol |
| IUPAC name | [3-[(2-chloro-4-methylphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | DKRYKTFMVWDUMU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=C(C=C(C=C2)C)Cl)(O)O |
Computed by PubChem (NCBI)