Products 957060-97-8

CAS 957060-97-8 is the registry number for 3-Borono-N-(2-chloro-4-methylphenyl)benzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 100g, 500g, 1g.

Structural formula: {0} (CAS {1})

[3-[(2-chloro-4-methylphenyl)carbamoyl]phenyl]boronic acid (CAS 957060-97-8) is a chemical compound with the molecular formula C14H13BClNO3 and a molecular weight of 289.52 g/mol. IUPAC name: [3-[(2-chloro-4-methylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: DKRYKTFMVWDUMU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13BClNO3
Molecular weight289.52 g/mol
IUPAC name[3-[(2-chloro-4-methylphenyl)carbamoyl]phenyl]boronic acid
InChIKeyDKRYKTFMVWDUMU-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)C(=O)NC2=C(C=C(C=C2)C)Cl)(O)O

Computed by PubChem (NCBI)