Products 874288-27-4
CAS 874288-27-4 appears in our catalog under these names: 3-(2-chlorobenzylcarbamoyl)phenylboronic acid, 95%, Boronic acid， b–(3–((((2–chlorophenyl)methyl)amino)carbonyl)phenyl)–, (3-((2-Chlorobenzyl)carbamoyl)phenyl)boronic acid, 95%, Boronic acid， b-[3-[[[(2-chlorophenyl)methyl]amino]carbonyl]phenyl]-, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg.
[3-[(2-chlorophenyl)methylcarbamoyl]phenyl]boronic acid (CAS 874288-27-4) is a chemical compound with the molecular formula C14H13BClNO3 and a molecular weight of 289.52 g/mol. IUPAC name: [3-[(2-chlorophenyl)methylcarbamoyl]phenyl]boronic acid. InChIKey: QSDMMYAOINICBD-UHFFFAOYSA-N.
| Molecular formula | C14H13BClNO3 |
|---|---|
| Molecular weight | 289.52 g/mol |
| IUPAC name | [3-[(2-chlorophenyl)methylcarbamoyl]phenyl]boronic acid |
| InChIKey | QSDMMYAOINICBD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NCC2=CC=CC=C2Cl)(O)O |
Computed by PubChem (NCBI)