CAS 1072946-08-7 appears in our catalog under these names: Ethyl (4-boronobenzoylamino)acetate, 96%, (4-((2-Ethoxy-2-oxoethyl)carbamoyl)phenyl)boronic acid 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 25g, 1g, 250mg.
[4-[(2-ethoxy-2-oxoethyl)carbamoyl]phenyl]boronic acid (CAS 1072946-08-7) is a chemical compound with the molecular formula C11H14BNO5 and a molecular weight of 251.05 g/mol. IUPAC name: [4-[(2-ethoxy-2-oxoethyl)carbamoyl]phenyl]boronic acid. InChIKey: BZBZSOPFQYUDJF-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO5 |
|---|---|
| Molecular weight | 251.05 g/mol |
| IUPAC name | [4-[(2-ethoxy-2-oxoethyl)carbamoyl]phenyl]boronic acid |
| InChIKey | BZBZSOPFQYUDJF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCC(=O)OCC)(O)O |
Computed by PubChem (NCBI)