CAS 957034-72-9 is the registry number for Methyl 3-(3-boronobenzamido)propionate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 100g, 1g.
[3-[(3-methoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid (CAS 957034-72-9) is a chemical compound with the molecular formula C11H14BNO5 and a molecular weight of 251.05 g/mol. IUPAC name: [3-[(3-methoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid. InChIKey: HOSNWHARMRFHGM-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO5 |
|---|---|
| Molecular weight | 251.05 g/mol |
| IUPAC name | [3-[(3-methoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid |
| InChIKey | HOSNWHARMRFHGM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NCCC(=O)OC)(O)O |
Computed by PubChem (NCBI)