Products 957034-72-9

CAS 957034-72-9 is the registry number for Methyl 3-(3-boronobenzamido)propionate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

[3-[(3-methoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid (CAS 957034-72-9) is a chemical compound with the molecular formula C11H14BNO5 and a molecular weight of 251.05 g/mol. IUPAC name: [3-[(3-methoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid. InChIKey: HOSNWHARMRFHGM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14BNO5
Molecular weight251.05 g/mol
IUPAC name[3-[(3-methoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid
InChIKeyHOSNWHARMRFHGM-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)C(=O)NCCC(=O)OC)(O)O

Computed by PubChem (NCBI)