CAS 957034-76-3 appears in our catalog under these names: (4-((3-Methoxy-3-oxopropyl)carbamoyl)phenyl)boronic acid 97%, Methyl 3-(4-boronobenzamido)propionate, 97%, Methyl 3-(4-boronobenzamido)propionate, 97%, 97%. Offered by: Ambeed, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
[4-[(3-methoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid (CAS 957034-76-3) is a chemical compound with the molecular formula C11H14BNO5 and a molecular weight of 251.05 g/mol. IUPAC name: [4-[(3-methoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid. InChIKey: NROXSDVUSUSOLU-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO5 |
|---|---|
| Molecular weight | 251.05 g/mol |
| IUPAC name | [4-[(3-methoxy-3-oxopropyl)carbamoyl]phenyl]boronic acid |
| InChIKey | NROXSDVUSUSOLU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCCC(=O)OC)(O)O |
Computed by PubChem (NCBI)