Products 2377607-76-4
CAS 2377607-76-4 appears in our catalog under these names: 4-(Methoxycarbonyl)-2-(trifluoromethyl)phenylboronic acid, 97%, 4-(METHOXYCARBONYL)-2-(TRIFLUOROMETHYL)PHENYLBORONIC ACID, 97%, 97%, (4-(Methoxycarbonyl)-2-(trifluoromethyl)phenyl)boronic acid, 97%. Offered by: Fluorochem, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
[4-methoxycarbonyl-2-(trifluoromethyl)phenyl]boronic acid (CAS 2377607-76-4) is a chemical compound with the molecular formula C9H8BF3O4 and a molecular weight of 247.97 g/mol. IUPAC name: [4-methoxycarbonyl-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: LCYSERDAAKUQEQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BF3O4 |
|---|---|
| Molecular weight | 247.97 g/mol |
| IUPAC name | [4-methoxycarbonyl-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | LCYSERDAAKUQEQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)