Products 1072952-03-4
CAS 1072952-03-4 appears in our catalog under these names: (3-((4-Fluorobenzyl)oxy)phenyl)boronic acid, 95%, 3–(4′–Fluorobenzyloxy)phenylboronic acid(contains varying amounts of Anhydride), (3-((4-fluorobenzyl)oxy)phenyl)boronic acid, 95%, 95%. Offered by: Fluorochem, Ambeed, GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
[3-[(4-fluorophenyl)methoxy]phenyl]boronic acid (CAS 1072952-03-4) is a chemical compound with the molecular formula C13H12BFO3 and a molecular weight of 246.04 g/mol. IUPAC name: [3-[(4-fluorophenyl)methoxy]phenyl]boronic acid. InChIKey: WSTWPQWJAKLITI-UHFFFAOYSA-N.
| Molecular formula | C13H12BFO3 |
|---|---|
| Molecular weight | 246.04 g/mol |
| IUPAC name | [3-[(4-fluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | WSTWPQWJAKLITI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-((4-Fluorobenzyl)oxy)phenyl)boronic acid, 3-(4'-Fluorobenzyloxy)phenylboronic acid, [3-[(4-fluorophenyl)methoxy]phenyl]boronic acid, {3-[(4-Fluorophenyl)methoxy]phenyl}boronic acid, 3-(4-Fluorobenzyloxy)phenylboronic acid, 3-[(4-Fluorobenzyl)oxy]phenylboronic Acid, (3-((4-Fluorobenzyl)oxy)phenyl)boronicacid