CAS 1073067-97-6 appears in our catalog under these names: Ethyl 7-bromo-3-(3-hydroxypropyl)-1h-indole-2-carboxylate, 95%, Ethyl 7-bromo-3-(3-hydroxypropyl)-1H-indole-2-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ethyl 7-bromo-3-(3-hydroxypropyl)-1H-indole-2-carboxylate (CAS 1073067-97-6) is a chemical compound with the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. IUPAC name: ethyl 7-bromo-3-(3-hydroxypropyl)-1H-indole-2-carboxylate. InChIKey: XKFBQKVPNUAJDF-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO3 |
|---|---|
| Molecular weight | 326.19 g/mol |
| IUPAC name | ethyl 7-bromo-3-(3-hydroxypropyl)-1H-indole-2-carboxylate |
| InChIKey | XKFBQKVPNUAJDF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)C(=CC=C2)Br)CCCO |
Computed by PubChem (NCBI)